C20H17ClN2O6S — CID 137162362
2-[4-[(Z)-[2-(5-chloro-2-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetic acid (PubChem CID 137162362) has the molecular formula C20H17ClN2O6S and a molecular weight of 448.88 g/mol. Its IUPAC name is 2-[4-[(Z)-[2-(5-chloro-2-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-[2-(5-chloro-2-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 137162362 |
| Molecular Formula | C20H17ClN2O6S |
| Molecular Weight | 448.88 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 2-[4-[(Z)-[2-(5-chloro-2-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetic acid |
| SMILES | COc1ccc(Cl)cc1/N=C1\NC(=O)/C(=C/c2ccc(OCC(=O)O)c(OC)c2)S1 |
| InChI | InChI=1S/C20H17ClN2O6S/c1-27-14-6-4-12(21)9-13(14)22-20-23-19(26)17(30-20)8-11-3-5-15(16(7-11)28-2)29-10-18(24)25/h3-9H,10H2,1-2H3,(H,24,25)(H,22,23,26)/b17-8- |
| InChIKey | UOTLNZVTVQYFRK-IUXPMGMMSA-N |
| XLogP | 3.71 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.88 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|