C8H9F3N4O2 — CID 137162931
6-methanimidoyl-1-methyl-5-(2,2,2-trifluoroethylamino)pyrimidine-2,4-dione (PubChem CID 137162931) has the molecular formula C8H9F3N4O2 and a molecular weight of 250.18 g/mol. Its IUPAC name is 6-methanimidoyl-1-methyl-5-(2,2,2-trifluoroethylamino)pyrimidine-2,4-dione.
| Compound Name | 6-methanimidoyl-1-methyl-5-(2,2,2-trifluoroethylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137162931 |
| Molecular Formula | C8H9F3N4O2 |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 6-methanimidoyl-1-methyl-5-(2,2,2-trifluoroethylamino)pyrimidine-2,4-dione |
| SMILES | [H]/N=C/c1c(NCC(F)(F)F)c(=O)[nH]c(=O)n1C |
| InChI | InChI=1S/C8H9F3N4O2/c1-15-4(2-12)5(6(16)14-7(15)17)13-3-8(9,10)11/h2,12-13H,3H2,1H3,(H,14,16,17)/b12-2+ |
| InChIKey | UCOFAFGQMYXWGN-SWGQDTFXSA-N |
| XLogP | 0.05 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|