C16H10N4O6S — CID 137165806
(5Z)-5-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]-2-(2-nitrophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137165806) has the molecular formula C16H10N4O6S and a molecular weight of 386.35 g/mol. Its IUPAC name is (5Z)-5-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]-2-(2-nitrophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]-2-(2-nitrophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137165806 |
| Molecular Formula | C16H10N4O6S |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | (5Z)-5-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]-2-(2-nitrophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccccc2[N+](=O)[O-])S/C1=C\C=C\c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C16H10N4O6S/c21-15-13(7-3-4-10-8-9-14(26-10)20(24)25)27-16(18-15)17-11-5-1-2-6-12(11)19(22)23/h1-9H,(H,17,18,21)/b4-3+,13-7- |
| InChIKey | ANCLPZQWXGISKX-ZPGGVYHDSA-N |
| XLogP | 3.54 |
| TPSA | 140.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|