C15H11N3O4S — CID 137165975
(5Z)-2-(furan-2-ylmethylimino)-5-[(4-nitrophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137165975) has the molecular formula C15H11N3O4S and a molecular weight of 329.34 g/mol. Its IUPAC name is (5Z)-2-(furan-2-ylmethylimino)-5-[(4-nitrophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(furan-2-ylmethylimino)-5-[(4-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137165975 |
| Molecular Formula | C15H11N3O4S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | (5Z)-2-(furan-2-ylmethylimino)-5-[(4-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\Cc2ccco2)S/C1=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H11N3O4S/c19-14-13(8-10-3-5-11(6-4-10)18(20)21)23-15(17-14)16-9-12-2-1-7-22-12/h1-8H,9H2,(H,16,17,19)/b13-8- |
| InChIKey | FAKWYZWVEWUDFP-JYRVWZFOSA-N |
| XLogP | 2.95 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|