C20H18N2O5S — CID 137166144
methyl 4-[[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 137166144) has the molecular formula C20H18N2O5S and a molecular weight of 398.44 g/mol. Its IUPAC name is methyl 4-[[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | methyl 4-[[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 137166144 |
| Molecular Formula | C20H18N2O5S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | methyl 4-[[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | COC(=O)c1ccc(/N=C2\NC(=O)/C(=C/c3ccc(OC)c(OC)c3)S2)cc1 |
| InChI | InChI=1S/C20H18N2O5S/c1-25-15-9-4-12(10-16(15)26-2)11-17-18(23)22-20(28-17)21-14-7-5-13(6-8-14)19(24)27-3/h4-11H,1-3H3,(H,21,22,23)/b17-11- |
| InChIKey | NRLHGOYCDNUBSU-BOPFTXTBSA-N |
| XLogP | 3.38 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|