C18H21N3O3S — CID 137166391
5-[(2-cyclohexylimino-4-methyl-1,3-thiazol-3-yl)iminomethyl]-2-hydroxybenzoic acid (PubChem CID 137166391) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is 5-[(2-cyclohexylimino-4-methyl-1,3-thiazol-3-yl)iminomethyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[(2-cyclohexylimino-4-methyl-1,3-thiazol-3-yl)iminomethyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 137166391 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 5-[(2-cyclohexylimino-4-methyl-1,3-thiazol-3-yl)iminomethyl]-2-hydroxybenzoic acid |
| SMILES | Cc1cs/c(=N\C2CCCCC2)n1N=Cc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C18H21N3O3S/c1-12-11-25-18(20-14-5-3-2-4-6-14)21(12)19-10-13-7-8-16(22)15(9-13)17(23)24/h7-11,14,22H,2-6H2,1H3,(H,23,24)/b19-10?,20-18- |
| InChIKey | LHOFGKSDNCUFSD-KGXZBLMRSA-N |
| XLogP | 3.38 |
| TPSA | 87.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|