C37H36FN3O — CID 137166838
2-[4-(3,5-ditert-butylphenyl)-6-(6-ethenyl-2-fluoro-5-pyridin-2-yl-3-pyridinyl)-2-pyridinyl]phenol (PubChem CID 137166838) has the molecular formula C37H36FN3O and a molecular weight of 557.71 g/mol. Its IUPAC name is 2-[4-(3,5-ditert-butylphenyl)-6-(6-ethenyl-2-fluoro-5-pyridin-2-yl-3-pyridinyl)-2-pyridinyl]phenol.
| Compound Name | 2-[4-(3,5-ditert-butylphenyl)-6-(6-ethenyl-2-fluoro-5-pyridin-2-yl-3-pyridinyl)-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 137166838 |
| Molecular Formula | C37H36FN3O |
| Molecular Weight | 557.71 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | 2-[4-(3,5-ditert-butylphenyl)-6-(6-ethenyl-2-fluoro-5-pyridin-2-yl-3-pyridinyl)-2-pyridinyl]phenol |
| SMILES | C=Cc1nc(F)c(-c2cc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)cc(-c3ccccc3O)n2)cc1-c1ccccn1 |
| InChI | InChI=1S/C37H36FN3O/c1-8-30-28(31-14-11-12-16-39-31)22-29(35(38)41-30)33-20-24(19-32(40-33)27-13-9-10-15-34(27)42)23-17-25(36(2,3)4)21-26(18-23)37(5,6)7/h8-22,42H,1H2,2-7H3 |
| InChIKey | BAHONKWQRYSZND-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.71 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|