C21H15Cl2FN2O3 — CID 137167166
4-chloro-2-(2-chloro-6-fluorophenyl)-6-[(2-hydroxy-4-methoxyphenyl)methyl]pyrrolo[3,4-b]pyridin-5-ol (PubChem CID 137167166) has the molecular formula C21H15Cl2FN2O3 and a molecular weight of 433.27 g/mol. Its IUPAC name is 4-chloro-2-(2-chloro-6-fluorophenyl)-6-[(2-hydroxy-4-methoxyphenyl)methyl]pyrrolo[3,4-b]pyridin-5-ol.
| Compound Name | 4-chloro-2-(2-chloro-6-fluorophenyl)-6-[(2-hydroxy-4-methoxyphenyl)methyl]pyrrolo[3,4-b]pyridin-5-ol |
|---|---|
| PubChem CID | 137167166 |
| Molecular Formula | C21H15Cl2FN2O3 |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 4-chloro-2-(2-chloro-6-fluorophenyl)-6-[(2-hydroxy-4-methoxyphenyl)methyl]pyrrolo[3,4-b]pyridin-5-ol |
| SMILES | COc1ccc(Cn2cc3nc(-c4c(F)cccc4Cl)cc(Cl)c3c2O)c(O)c1 |
| InChI | InChI=1S/C21H15Cl2FN2O3/c1-29-12-6-5-11(18(27)7-12)9-26-10-17-20(21(26)28)14(23)8-16(25-17)19-13(22)3-2-4-15(19)24/h2-8,10,27-28H,9H2,1H3 |
| InChIKey | FWQVWGHGTIOVOT-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|