C16H21N7O3 — CID 137167181
(Z)-5-[(2-amino-5-formyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl)methylimino]-2-ethylidenehex-3-enamide (PubChem CID 137167181) has the molecular formula C16H21N7O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is (Z)-5-[(2-amino-5-formyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl)methylimino]-2-ethylidenehex-3-enamide.
| Compound Name | (Z)-5-[(2-amino-5-formyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl)methylimino]-2-ethylidenehex-3-enamide |
|---|---|
| PubChem CID | 137167181 |
| Molecular Formula | C16H21N7O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (Z)-5-[(2-amino-5-formyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl)methylimino]-2-ethylidenehex-3-enamide |
| SMILES | CC=C(/C=C\C(C)=N\CC1CNc2nc(N)[nH]c(=O)c2N1C=O)C(N)=O |
| InChI | InChI=1S/C16H21N7O3/c1-3-10(13(17)25)5-4-9(2)19-6-11-7-20-14-12(23(11)8-24)15(26)22-16(18)21-14/h3-5,8,11H,6-7H2,1-2H3,(H2,17,25)(H4,18,20,21,22,26)/b5-4-,10-3?,19-9+ |
| InChIKey | HFVYDMOBVFOTLE-MBFAKWPKSA-N |
| XLogP | -0.44 |
| TPSA | 159.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|