C30H12F12N4S4 — CID 137167430
4,8-bis[5-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]-5,7-dihydro-[1,2,5]thiadiazolo[3,4-f][2,1,3]benzothiadiazole (PubChem CID 137167430) has the molecular formula C30H12F12N4S4 and a molecular weight of 784.70 g/mol. Its IUPAC name is 4,8-bis[5-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]-5,7-dihydro-[1,2,5]thiadiazolo[3,4-f][2,1,3]benzothiadiazole.
| Compound Name | 4,8-bis[5-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]-5,7-dihydro-[1,2,5]thiadiazolo[3,4-f][2,1,3]benzothiadiazole |
|---|---|
| PubChem CID | 137167430 |
| Molecular Formula | C30H12F12N4S4 |
| Molecular Weight | 784.70 g/mol |
| Exact Mass | 783.98 |
| IUPAC Name | 4,8-bis[5-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]-5,7-dihydro-[1,2,5]thiadiazolo[3,4-f][2,1,3]benzothiadiazole |
| SMILES | FC(F)(F)c1cc(-c2ccc(-c3c4c(c(-c5ccc(-c6cc(C(F)(F)F)cc(C(F)(F)F)c6)s5)c5nsnc35)NSN4)s2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H12F12N4S4/c31-27(32,33)13-5-11(6-14(9-13)28(34,35)36)17-1-3-19(47-17)21-23-25(45-49-43-23)22(26-24(21)44-50-46-26)20-4-2-18(48-20)12-7-15(29(37,38)39)10-16(8-12)30(40,41)42/h1-10,43,45H |
| InChIKey | ZVTRTFWIYAPTDZ-UHFFFAOYSA-N |
| XLogP | 12.96 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.70 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|