About N-ethyl-3-methyl-4-oxo-7H-[1,2]thiazolo[5,4-b]pyridine-5-carboxamide
N-ethyl-3-methyl-4-oxo-7H-[1,2]thiazolo[5,4-b]pyridine-5-carboxamide (PubChem CID 137167483) has the molecular formula C10H11N3O2S
and a molecular weight of 237.28 g/mol. Its IUPAC name is N-ethyl-3-methyl-4-oxo-7H-[1,2]thiazolo[5,4-b]pyridine-5-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-3-methyl-4-oxo-7H-[1,2]thiazolo[5,4-b]pyridine-5-carboxamide |
| PubChem CID | 137167483 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | N-ethyl-3-methyl-4-oxo-7H-[1,2]thiazolo[5,4-b]pyridine-5-carboxamide |
| SMILES | CCNC(=O)c1c[nH]c2snc(C)c2c1=O |
| InChI | InChI=1S/C10H11N3O2S/c1-3-11-9(15)6-4-12-10-7(8(6)14)5(2)13-16-10/h4H,3H2,1-2H3,(H,11,15)(H,12,14) |
| InChIKey | ZHMYXWHVRKRSKS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-3-methyl-4-oxo-7H-[1,2]thiazolo[5,4-b]pyridine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-methyl-4-oxo-7H-[1,2]thiazolo[5,4-b]pyridine-5-carboxamide?
The IUPAC name of N-ethyl-3-methyl-4-oxo-7H-[1,2]thiazolo[5,4-b]pyridine-5-carboxamide (CID 137167483) is N-ethyl-3-methyl-4-oxo-7H-[1,2]thiazolo[5,4-b]pyridine-5-carboxamide.
What is the SMILES notation for N-ethyl-3-methyl-4-oxo-7H-[1,2]thiazolo[5,4-b]pyridine-5-carboxamide?
The canonical SMILES for N-ethyl-3-methyl-4-oxo-7H-[1,2]thiazolo[5,4-b]pyridine-5-carboxamide is CCNC(=O)c1c[nH]c2snc(C)c2c1=O.
What is the InChIKey of N-ethyl-3-methyl-4-oxo-7H-[1,2]thiazolo[5,4-b]pyridine-5-carboxamide?
The InChIKey is ZHMYXWHVRKRSKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2S/c1-3-11-9(15)6-4-12-10-7(8(6)14)5(2)13-16-10/h4H,3H2,1-2H3,(H,11,15)(H,12,14).
What are the key properties of N-ethyl-3-methyl-4-oxo-7H-[1,2]thiazolo[5,4-b]pyridine-5-carboxamide?
N-ethyl-3-methyl-4-oxo-7H-[1,2]thiazolo[5,4-b]pyridine-5-carboxamide has a molecular weight of 237.28 g/mol, XLogP of 1.04, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-methyl-4-oxo-7H-[1,2]thiazolo[5,4-b]pyridine-5-carboxamide is sourced from PubChem (CID 137167483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).