About 1-methyl-8,9-dihydro-7H-purine-2-thione
1-methyl-8,9-dihydro-7H-purine-2-thione (PubChem CID 137167524) has the molecular formula C6H8N4S
and a molecular weight of 168.22 g/mol. Its IUPAC name is 1-methyl-8,9-dihydro-7H-purine-2-thione.
Molecular Properties
| Compound Name | 1-methyl-8,9-dihydro-7H-purine-2-thione |
| PubChem CID | 137167524 |
| Molecular Formula | C6H8N4S |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 1-methyl-8,9-dihydro-7H-purine-2-thione |
| SMILES | Cn1cc2c(nc1=S)NCN2 |
| InChI | InChI=1S/C6H8N4S/c1-10-2-4-5(8-3-7-4)9-6(10)11/h2,7H,3H2,1H3,(H,8,9,11) |
| InChIKey | HJMBFWFDPSINQX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-8,9-dihydro-7H-purine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-8,9-dihydro-7H-purine-2-thione?
The IUPAC name of 1-methyl-8,9-dihydro-7H-purine-2-thione (CID 137167524) is 1-methyl-8,9-dihydro-7H-purine-2-thione.
What is the SMILES notation for 1-methyl-8,9-dihydro-7H-purine-2-thione?
The canonical SMILES for 1-methyl-8,9-dihydro-7H-purine-2-thione is Cn1cc2c(nc1=S)NCN2.
What is the InChIKey of 1-methyl-8,9-dihydro-7H-purine-2-thione?
The InChIKey is HJMBFWFDPSINQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4S/c1-10-2-4-5(8-3-7-4)9-6(10)11/h2,7H,3H2,1H3,(H,8,9,11).
What are the key properties of 1-methyl-8,9-dihydro-7H-purine-2-thione?
1-methyl-8,9-dihydro-7H-purine-2-thione has a molecular weight of 168.22 g/mol, XLogP of 0.94, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-8,9-dihydro-7H-purine-2-thione is sourced from PubChem (CID 137167524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).