C23H28N6O — CID 137167663
3-[3-[(4-imino-2,3,7-trimethyl-1H-indol-5-ylidene)amino]pyrazolo[1,5-a]pyridin-2-yl]oxy-N,N-dimethylpropan-1-amine (PubChem CID 137167663) has the molecular formula C23H28N6O and a molecular weight of 404.52 g/mol. Its IUPAC name is 3-[3-[(4-imino-2,3,7-trimethyl-1H-indol-5-ylidene)amino]pyrazolo[1,5-a]pyridin-2-yl]oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[3-[(4-imino-2,3,7-trimethyl-1H-indol-5-ylidene)amino]pyrazolo[1,5-a]pyridin-2-yl]oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 137167663 |
| Molecular Formula | C23H28N6O |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 3-[3-[(4-imino-2,3,7-trimethyl-1H-indol-5-ylidene)amino]pyrazolo[1,5-a]pyridin-2-yl]oxy-N,N-dimethylpropan-1-amine |
| SMILES | [H]/N=C1C(=N\c2c(OCCCN(C)C)nn3ccccc23)\C=C(C)c2[nH]c(C)c(C)c2\1 |
| InChI | InChI=1S/C23H28N6O/c1-14-13-17(20(24)19-15(2)16(3)25-21(14)19)26-22-18-9-6-7-11-29(18)27-23(22)30-12-8-10-28(4)5/h6-7,9,11,13,24-25H,8,10,12H2,1-5H3/b24-20+,26-17+ |
| InChIKey | QVPOVSPEHVGVMA-OREWWLCJSA-N |
| XLogP | 4.17 |
| TPSA | 81.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|