C22H24N6O — CID 137169826
1-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]amino]-2,3-dihydro-1H-inden-2-ol (PubChem CID 137169826) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is 1-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]amino]-2,3-dihydro-1H-inden-2-ol.
| Compound Name | 1-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]amino]-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 137169826 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]amino]-2,3-dihydro-1H-inden-2-ol |
| SMILES | OC1Cc2ccccc2C1NC1CCC(c2nnn3cnc4[nH]ccc4c23)CC1 |
| InChI | InChI=1S/C22H24N6O/c29-18-11-14-3-1-2-4-16(14)20(18)25-15-7-5-13(6-8-15)19-21-17-9-10-23-22(17)24-12-28(21)27-26-19/h1-4,9-10,12-13,15,18,20,23,25,29H,5-8,11H2 |
| InChIKey | AMBOJIFBTQQSPL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |