C22H19ClN2O2S — CID 137172349
4-[(4-chlorophenyl)sulfanylmethyl]-N-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]benzamide (PubChem CID 137172349) has the molecular formula C22H19ClN2O2S and a molecular weight of 410.93 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)sulfanylmethyl]-N-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]benzamide.
| Compound Name | 4-[(4-chlorophenyl)sulfanylmethyl]-N-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 137172349 |
| Molecular Formula | C22H19ClN2O2S |
| Molecular Weight | 410.93 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 4-[(4-chlorophenyl)sulfanylmethyl]-N-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]benzamide |
| SMILES | C/C(=N/NC(=O)c1ccc(CSc2ccc(Cl)cc2)cc1)c1ccccc1O |
| InChI | InChI=1S/C22H19ClN2O2S/c1-15(20-4-2-3-5-21(20)26)24-25-22(27)17-8-6-16(7-9-17)14-28-19-12-10-18(23)11-13-19/h2-13,26H,14H2,1H3,(H,25,27)/b24-15- |
| InChIKey | OASFJWRUHARIKG-IWIPYMOSSA-N |
| XLogP | 5.49 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.93 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|