C14H13ClN4O2S — CID 137174469
1-(3-chlorophenyl)-6-(3-hydroxypropylsulfanyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 137174469) has the molecular formula C14H13ClN4O2S and a molecular weight of 336.80 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-6-(3-hydroxypropylsulfanyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 1-(3-chlorophenyl)-6-(3-hydroxypropylsulfanyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137174469 |
| Molecular Formula | C14H13ClN4O2S |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 1-(3-chlorophenyl)-6-(3-hydroxypropylsulfanyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(SCCCO)nc2c1cnn2-c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H13ClN4O2S/c15-9-3-1-4-10(7-9)19-12-11(8-16-19)13(21)18-14(17-12)22-6-2-5-20/h1,3-4,7-8,20H,2,5-6H2,(H,17,18,21) |
| InChIKey | XUAFQJABDQGXQP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|