About 2-(N,S-dimethylsulfonimidoyl)-4-methyl-1H-pyrimidin-6-one
2-(N,S-dimethylsulfonimidoyl)-4-methyl-1H-pyrimidin-6-one (PubChem CID 137174767) has the molecular formula C7H11N3O2S
and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-(N,S-dimethylsulfonimidoyl)-4-methyl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-(N,S-dimethylsulfonimidoyl)-4-methyl-1H-pyrimidin-6-one |
| PubChem CID | 137174767 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2-(N,S-dimethylsulfonimidoyl)-4-methyl-1H-pyrimidin-6-one |
| SMILES | CN=S(C)(=O)c1nc(C)cc(=O)[nH]1 |
| InChI | InChI=1S/C7H11N3O2S/c1-5-4-6(11)10-7(9-5)13(3,12)8-2/h4H,1-3H3,(H,9,10,11) |
| InChIKey | WSHBRNKLSDQBGQ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(N,S-dimethylsulfonimidoyl)-4-methyl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N,S-dimethylsulfonimidoyl)-4-methyl-1H-pyrimidin-6-one?
The IUPAC name of 2-(N,S-dimethylsulfonimidoyl)-4-methyl-1H-pyrimidin-6-one (CID 137174767) is 2-(N,S-dimethylsulfonimidoyl)-4-methyl-1H-pyrimidin-6-one.
What is the SMILES notation for 2-(N,S-dimethylsulfonimidoyl)-4-methyl-1H-pyrimidin-6-one?
The canonical SMILES for 2-(N,S-dimethylsulfonimidoyl)-4-methyl-1H-pyrimidin-6-one is CN=S(C)(=O)c1nc(C)cc(=O)[nH]1.
What is the InChIKey of 2-(N,S-dimethylsulfonimidoyl)-4-methyl-1H-pyrimidin-6-one?
The InChIKey is WSHBRNKLSDQBGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2S/c1-5-4-6(11)10-7(9-5)13(3,12)8-2/h4H,1-3H3,(H,9,10,11).
What are the key properties of 2-(N,S-dimethylsulfonimidoyl)-4-methyl-1H-pyrimidin-6-one?
2-(N,S-dimethylsulfonimidoyl)-4-methyl-1H-pyrimidin-6-one has a molecular weight of 201.25 g/mol, XLogP of 0.16, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N,S-dimethylsulfonimidoyl)-4-methyl-1H-pyrimidin-6-one is sourced from PubChem (CID 137174767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).