C15H15N5OS2 — CID 137174943
2-[5-(1H-pyrrol-3-yl)-1,3,4-oxadiazol-2-yl]ethyl N-(pyridin-3-ylmethyl)carbamodithioate (PubChem CID 137174943) has the molecular formula C15H15N5OS2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 2-[5-(1H-pyrrol-3-yl)-1,3,4-oxadiazol-2-yl]ethyl N-(pyridin-3-ylmethyl)carbamodithioate.
| Compound Name | 2-[5-(1H-pyrrol-3-yl)-1,3,4-oxadiazol-2-yl]ethyl N-(pyridin-3-ylmethyl)carbamodithioate |
|---|---|
| PubChem CID | 137174943 |
| Molecular Formula | C15H15N5OS2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 2-[5-(1H-pyrrol-3-yl)-1,3,4-oxadiazol-2-yl]ethyl N-(pyridin-3-ylmethyl)carbamodithioate |
| SMILES | S=C(NCc1cccnc1)SCCc1nnc(-c2cc[nH]c2)o1 |
| InChI | InChI=1S/C15H15N5OS2/c22-15(18-9-11-2-1-5-16-8-11)23-7-4-13-19-20-14(21-13)12-3-6-17-10-12/h1-3,5-6,8,10,17H,4,7,9H2,(H,18,22) |
| InChIKey | FZGUTFFTYMVBCD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|