C11H7F5N2O — CID 137175065
2-[5-(1,1,2,2,2-pentafluoroethyl)-1H-pyrazol-3-yl]phenol (PubChem CID 137175065) has the molecular formula C11H7F5N2O and a molecular weight of 278.18 g/mol. Its IUPAC name is 2-[5-(1,1,2,2,2-pentafluoroethyl)-1H-pyrazol-3-yl]phenol.
| Compound Name | 2-[5-(1,1,2,2,2-pentafluoroethyl)-1H-pyrazol-3-yl]phenol |
|---|---|
| PubChem CID | 137175065 |
| Molecular Formula | C11H7F5N2O |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-[5-(1,1,2,2,2-pentafluoroethyl)-1H-pyrazol-3-yl]phenol |
| SMILES | Oc1ccccc1-c1cc(C(F)(F)C(F)(F)F)[nH]n1 |
| InChI | InChI=1S/C11H7F5N2O/c12-10(13,11(14,15)16)9-5-7(17-18-9)6-3-1-2-4-8(6)19/h1-5,19H,(H,17,18) |
| InChIKey | BFVLMIOZDXXEJU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|