C10H9N3O2S — CID 137175100
3-benzylsulfanyl-1,4-dihydro-1,2,4-triazine-5,6-dione (PubChem CID 137175100) has the molecular formula C10H9N3O2S and a molecular weight of 235.27 g/mol. Its IUPAC name is 3-benzylsulfanyl-1,4-dihydro-1,2,4-triazine-5,6-dione.
| Compound Name | 3-benzylsulfanyl-1,4-dihydro-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 137175100 |
| Molecular Formula | C10H9N3O2S |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 3-benzylsulfanyl-1,4-dihydro-1,2,4-triazine-5,6-dione |
| SMILES | O=c1[nH]nc(SCc2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C10H9N3O2S/c14-8-9(15)12-13-10(11-8)16-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,12,15)(H,11,13,14) |
| InChIKey | HDNJAEWUEMUHPD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|