C14H17N3O2S — CID 137175103
3-[(4-tert-butylphenyl)methylsulfanyl]-1,4-dihydro-1,2,4-triazine-5,6-dione (PubChem CID 137175103) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 3-[(4-tert-butylphenyl)methylsulfanyl]-1,4-dihydro-1,2,4-triazine-5,6-dione.
| Compound Name | 3-[(4-tert-butylphenyl)methylsulfanyl]-1,4-dihydro-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 137175103 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 3-[(4-tert-butylphenyl)methylsulfanyl]-1,4-dihydro-1,2,4-triazine-5,6-dione |
| SMILES | CC(C)(C)c1ccc(CSc2n[nH]c(=O)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C14H17N3O2S/c1-14(2,3)10-6-4-9(5-7-10)8-20-13-15-11(18)12(19)16-17-13/h4-7H,8H2,1-3H3,(H,16,19)(H,15,17,18) |
| InChIKey | PLGXCUMNCWHFOJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|