C20H24IN7O6 — CID 137176257
(2S)-2-[[4-[(2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-(iodomethyl)pentanedioic acid (PubChem CID 137176257) has the molecular formula C20H24IN7O6 and a molecular weight of 585.36 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-(iodomethyl)pentanedioic acid.
| Compound Name | (2S)-2-[[4-[(2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-(iodomethyl)pentanedioic acid |
|---|---|
| PubChem CID | 137176257 |
| Molecular Formula | C20H24IN7O6 |
| Molecular Weight | 585.36 g/mol |
| Exact Mass | 585.08 |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-(iodomethyl)pentanedioic acid |
| SMILES | Nc1nc2c(c(=O)[nH]1)NC(CNc1ccc(C(=O)N[C@@H](CC(CI)C(=O)O)C(=O)O)cc1)CN2 |
| InChI | InChI=1S/C20H24IN7O6/c21-6-10(18(31)32)5-13(19(33)34)26-16(29)9-1-3-11(4-2-9)23-7-12-8-24-15-14(25-12)17(30)28-20(22)27-15/h1-4,10,12-13,23,25H,5-8H2,(H,26,29)(H,31,32)(H,33,34)(H4,22,24,27,28,30)/t10?,12?,13-/m0/s1 |
| InChIKey | RXYRTJUJMDZCGI-GDKBPFBDSA-N |
| XLogP | 0.38 |
| TPSA | 211.56 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.36 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|