C16H14N4OS — CID 137176278
3-(phenylsulfanylmethyl)-2,5,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),6,10,12-tetraen-8-one (PubChem CID 137176278) has the molecular formula C16H14N4OS and a molecular weight of 310.38 g/mol. Its IUPAC name is 3-(phenylsulfanylmethyl)-2,5,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),6,10,12-tetraen-8-one.
| Compound Name | 3-(phenylsulfanylmethyl)-2,5,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),6,10,12-tetraen-8-one |
|---|---|
| PubChem CID | 137176278 |
| Molecular Formula | C16H14N4OS |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 3-(phenylsulfanylmethyl)-2,5,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),6,10,12-tetraen-8-one |
| SMILES | O=c1nc2n(c3ncccc13)C(CSc1ccccc1)CN2 |
| InChI | InChI=1S/C16H14N4OS/c21-15-13-7-4-8-17-14(13)20-11(9-18-16(20)19-15)10-22-12-5-2-1-3-6-12/h1-8,11H,9-10H2,(H,18,19,21) |
| InChIKey | QUYKHUBAYYLFIO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |