About barium(2+);bis(3,4,5-trihydroxyselenobenzate)
barium(2+);bis(3,4,5-trihydroxyselenobenzate) (PubChem CID 137176414) has the molecular formula C14H10BaO8Se2
and a molecular weight of 601.47 g/mol. Its IUPAC name is barium(2+);bis(3,4,5-trihydroxyselenobenzate).
Molecular Properties
| Compound Name | barium(2+);bis(3,4,5-trihydroxyselenobenzate) |
| PubChem CID | 137176414 |
| Molecular Formula | C14H10BaO8Se2 |
| Molecular Weight | 601.47 g/mol |
| Exact Mass | 603.78 |
| IUPAC Name | barium(2+);bis(3,4,5-trihydroxyselenobenzate) |
| SMILES | [Ba+2].[O-]C(=[Se])c1cc(O)c(O)c(O)c1.[O-]C(=[Se])c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/2C7H6O4Se.Ba/c2*8-4-1-3(7(11)12)2-5(9)6(4)10;/h2*1-2,8-10H,(H,11,12);/q;;+2/p-2 |
| InChIKey | CFUGOZGAIPGGSI-UHFFFAOYSA-L |
| XLogP | -2.76 |
| TPSA | 167.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 601.47 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);bis(3,4,5-trihydroxyselenobenzate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(3,4,5-trihydroxyselenobenzate)?
The IUPAC name of barium(2+);bis(3,4,5-trihydroxyselenobenzate) (CID 137176414) is barium(2+);bis(3,4,5-trihydroxyselenobenzate).
What is the SMILES notation for barium(2+);bis(3,4,5-trihydroxyselenobenzate)?
The canonical SMILES for barium(2+);bis(3,4,5-trihydroxyselenobenzate) is [Ba+2].[O-]C(=[Se])c1cc(O)c(O)c(O)c1.[O-]C(=[Se])c1cc(O)c(O)c(O)c1.
What is the InChIKey of barium(2+);bis(3,4,5-trihydroxyselenobenzate)?
The InChIKey is CFUGOZGAIPGGSI-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H6O4Se.Ba/c2*8-4-1-3(7(11)12)2-5(9)6(4)10;/h2*1-2,8-10H,(H,11,12);/q;;+2/p-2.
What are the key properties of barium(2+);bis(3,4,5-trihydroxyselenobenzate)?
barium(2+);bis(3,4,5-trihydroxyselenobenzate) has a molecular weight of 601.47 g/mol, XLogP of -2.76, 2 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(3,4,5-trihydroxyselenobenzate) is sourced from PubChem (CID 137176414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).