C18H17F2N5O3 — CID 137176912
1-(4,4-difluorocyclohexyl)-6-[(2-nitrophenyl)methyl]-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 137176912) has the molecular formula C18H17F2N5O3 and a molecular weight of 389.36 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-6-[(2-nitrophenyl)methyl]-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 1-(4,4-difluorocyclohexyl)-6-[(2-nitrophenyl)methyl]-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137176912 |
| Molecular Formula | C18H17F2N5O3 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-6-[(2-nitrophenyl)methyl]-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(Cc2ccccc2[N+](=O)[O-])nc2c1cnn2C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C18H17F2N5O3/c19-18(20)7-5-12(6-8-18)24-16-13(10-21-24)17(26)23-15(22-16)9-11-3-1-2-4-14(11)25(27)28/h1-4,10,12H,5-9H2,(H,22,23,26) |
| InChIKey | PZKUZFSZLJJUHA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|