C30H33FN8O — CID 137177826
cyclohexyl-[[5-[4-fluoro-3-(4-piperidin-1-yl-1H-imidazo[4,5-c]pyridin-2-yl)-1H-indazol-5-yl]-3-pyridinyl]amino]methanol (PubChem CID 137177826) has the molecular formula C30H33FN8O and a molecular weight of 540.65 g/mol. Its IUPAC name is cyclohexyl-[[5-[4-fluoro-3-(4-piperidin-1-yl-1H-imidazo[4,5-c]pyridin-2-yl)-1H-indazol-5-yl]-3-pyridinyl]amino]methanol.
| Compound Name | cyclohexyl-[[5-[4-fluoro-3-(4-piperidin-1-yl-1H-imidazo[4,5-c]pyridin-2-yl)-1H-indazol-5-yl]-3-pyridinyl]amino]methanol |
|---|---|
| PubChem CID | 137177826 |
| Molecular Formula | C30H33FN8O |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | cyclohexyl-[[5-[4-fluoro-3-(4-piperidin-1-yl-1H-imidazo[4,5-c]pyridin-2-yl)-1H-indazol-5-yl]-3-pyridinyl]amino]methanol |
| SMILES | OC(Nc1cncc(-c2ccc3[nH]nc(-c4nc5c(N6CCCCC6)nccc5[nH]4)c3c2F)c1)C1CCCCC1 |
| InChI | InChI=1S/C30H33FN8O/c31-25-21(19-15-20(17-32-16-19)34-30(40)18-7-3-1-4-8-18)9-10-22-24(25)27(38-37-22)28-35-23-11-12-33-29(26(23)36-28)39-13-5-2-6-14-39/h9-12,15-18,30,34,40H,1-8,13-14H2,(H,35,36)(H,37,38) |
| InChIKey | WZTAIZYZKMULCS-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|