C38H36CaN14O12 — CID 137178700
calcium bis((4S)-4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-hydroxy-5-oxopentanoate) (PubChem CID 137178700) has the molecular formula C38H36CaN14O12 and a molecular weight of 920.87 g/mol. Its IUPAC name is calcium bis((4S)-4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-hydroxy-5-oxopentanoate).
| Compound Name | calcium bis((4S)-4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-hydroxy-5-oxopentanoate) |
|---|---|
| PubChem CID | 137178700 |
| Molecular Formula | C38H36CaN14O12 |
| Molecular Weight | 920.87 g/mol |
| Exact Mass | 920.23 |
| IUPAC Name | calcium bis((4S)-4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-hydroxy-5-oxopentanoate) |
| SMILES | Nc1nc2ncc(CNc3ccc(C(=O)N[C@@H](CCC(=O)[O-])C(=O)O)cc3)nc2c(=O)[nH]1.Nc1nc2ncc(CNc3ccc(C(=O)N[C@@H](CCC(=O)[O-])C(=O)O)cc3)nc2c(=O)[nH]1.[Ca+2] |
| InChI | InChI=1S/2C19H19N7O6.Ca/c2*20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28;/h2*1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30);/q;;+2/p-2/t2*12-;/m00./s1 |
| InChIKey | HGYRJXCWGJBMNZ-NMFAMCKASA-L |
| XLogP | -3.14 |
| TPSA | 432.22 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.87 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 20 |