C17H25F2N7O — CID 137179000
(NZ)-N-[4-[[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-5-methanimidoylpyrimidin-4-yl]amino]-3-iminobutan-2-ylidene]hydroxylamine (PubChem CID 137179000) has the molecular formula C17H25F2N7O and a molecular weight of 381.43 g/mol. Its IUPAC name is (NZ)-N-[4-[[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-5-methanimidoylpyrimidin-4-yl]amino]-3-iminobutan-2-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[4-[[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-5-methanimidoylpyrimidin-4-yl]amino]-3-iminobutan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 137179000 |
| Molecular Formula | C17H25F2N7O |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (NZ)-N-[4-[[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-5-methanimidoylpyrimidin-4-yl]amino]-3-iminobutan-2-ylidene]hydroxylamine |
| SMILES | [H]/N=C(CNc1nc(C(C)(C)C)nc(N2CCC(F)(F)C2)c1/C=N/[H])\C(C)=N/O |
| InChI | InChI=1S/C17H25F2N7O/c1-10(25-27)12(21)8-22-13-11(7-20)14(24-15(23-13)16(2,3)4)26-6-5-17(18,19)9-26/h7,20-21,27H,5-6,8-9H2,1-4H3,(H,22,23,24)/b20-7+,21-12-,25-10- |
| InChIKey | YKNGMXHKFLEVNH-PNUKQBLYSA-N |
| XLogP | 2.90 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|