About 6-(trifluoromethyl)-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-7-carbaldehyde
6-(trifluoromethyl)-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-7-carbaldehyde (PubChem CID 137179077) has the molecular formula C7H6F3N3O
and a molecular weight of 205.14 g/mol. Its IUPAC name is 6-(trifluoromethyl)-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-7-carbaldehyde.
Molecular Properties
| Compound Name | 6-(trifluoromethyl)-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-7-carbaldehyde |
| PubChem CID | 137179077 |
| Molecular Formula | C7H6F3N3O |
| Molecular Weight | 205.14 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 6-(trifluoromethyl)-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-7-carbaldehyde |
| SMILES | O=Cc1c(C(F)(F)F)nn2c1NCC2 |
| InChI | InChI=1S/C7H6F3N3O/c8-7(9,10)5-4(3-14)6-11-1-2-13(6)12-5/h3,11H,1-2H2 |
| InChIKey | VJEBDZKTCXFMOI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.14 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-(trifluoromethyl)-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-7-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(trifluoromethyl)-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-7-carbaldehyde?
The IUPAC name of 6-(trifluoromethyl)-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-7-carbaldehyde (CID 137179077) is 6-(trifluoromethyl)-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-7-carbaldehyde.
What is the SMILES notation for 6-(trifluoromethyl)-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-7-carbaldehyde?
The canonical SMILES for 6-(trifluoromethyl)-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-7-carbaldehyde is O=Cc1c(C(F)(F)F)nn2c1NCC2.
What is the InChIKey of 6-(trifluoromethyl)-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-7-carbaldehyde?
The InChIKey is VJEBDZKTCXFMOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3N3O/c8-7(9,10)5-4(3-14)6-11-1-2-13(6)12-5/h3,11H,1-2H2.
What are the key properties of 6-(trifluoromethyl)-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-7-carbaldehyde?
6-(trifluoromethyl)-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-7-carbaldehyde has a molecular weight of 205.14 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(trifluoromethyl)-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-7-carbaldehyde is sourced from PubChem (CID 137179077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).