C26H23F4N5O2 — CID 137179204
6-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-3-(2H-tetrazol-5-yl)-1H-pyridin-2-one (PubChem CID 137179204) has the molecular formula C26H23F4N5O2 and a molecular weight of 513.50 g/mol. Its IUPAC name is 6-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-3-(2H-tetrazol-5-yl)-1H-pyridin-2-one.
| Compound Name | 6-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-3-(2H-tetrazol-5-yl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 137179204 |
| Molecular Formula | C26H23F4N5O2 |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 6-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-3-(2H-tetrazol-5-yl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]c(-c2ccc(OCCCC(F)(F)F)cc2F)cc(-c2ccc3c(c2)CCCC3)c1-c1nn[nH]n1 |
| InChI | InChI=1S/C26H23F4N5O2/c27-21-13-18(37-11-3-10-26(28,29)30)8-9-19(21)22-14-20(23(25(36)31-22)24-32-34-35-33-24)17-7-6-15-4-1-2-5-16(15)12-17/h6-9,12-14H,1-5,10-11H2,(H,31,36)(H,32,33,34,35) |
| InChIKey | HNSLSZGOBJYGPM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|