C22H19F4N5O3S — CID 137179230
4-(5-ethylthiophen-2-yl)-6-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-3-(5-oxo-1H-tetrazol-4-yl)-1H-pyridin-2-one (PubChem CID 137179230) has the molecular formula C22H19F4N5O3S and a molecular weight of 509.49 g/mol. Its IUPAC name is 4-(5-ethylthiophen-2-yl)-6-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-3-(5-oxo-1H-tetrazol-4-yl)-1H-pyridin-2-one.
| Compound Name | 4-(5-ethylthiophen-2-yl)-6-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-3-(5-oxo-1H-tetrazol-4-yl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 137179230 |
| Molecular Formula | C22H19F4N5O3S |
| Molecular Weight | 509.49 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | 4-(5-ethylthiophen-2-yl)-6-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-3-(5-oxo-1H-tetrazol-4-yl)-1H-pyridin-2-one |
| SMILES | CCc1ccc(-c2cc(-c3ccc(OCCCC(F)(F)F)cc3F)[nH]c(=O)c2-n2nn[nH]c2=O)s1 |
| InChI | InChI=1S/C22H19F4N5O3S/c1-2-13-5-7-18(35-13)15-11-17(27-20(32)19(15)31-21(33)28-29-30-31)14-6-4-12(10-16(14)23)34-9-3-8-22(24,25)26/h4-7,10-11H,2-3,8-9H2,1H3,(H,27,32)(H,28,30,33) |
| InChIKey | XPWCYPXZPUUTEA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|