About 6-amino-3-methyl-7,9-dihydropurine-2,8-dione
6-amino-3-methyl-7,9-dihydropurine-2,8-dione (PubChem CID 137180919) has the molecular formula C6H7N5O2
and a molecular weight of 181.16 g/mol. Its IUPAC name is 6-amino-3-methyl-7,9-dihydropurine-2,8-dione.
Molecular Properties
| Compound Name | 6-amino-3-methyl-7,9-dihydropurine-2,8-dione |
| PubChem CID | 137180919 |
| Molecular Formula | C6H7N5O2 |
| Molecular Weight | 181.16 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 6-amino-3-methyl-7,9-dihydropurine-2,8-dione |
| SMILES | Cn1c(=O)nc(N)c2[nH]c(=O)[nH]c21 |
| InChI | InChI=1S/C6H7N5O2/c1-11-4-2(8-5(12)10-4)3(7)9-6(11)13/h1H3,(H2,7,9,13)(H2,8,10,12) |
| InChIKey | BSAPZRLBMDNWIP-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.16 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-amino-3-methyl-7,9-dihydropurine-2,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3-methyl-7,9-dihydropurine-2,8-dione?
The IUPAC name of 6-amino-3-methyl-7,9-dihydropurine-2,8-dione (CID 137180919) is 6-amino-3-methyl-7,9-dihydropurine-2,8-dione.
What is the SMILES notation for 6-amino-3-methyl-7,9-dihydropurine-2,8-dione?
The canonical SMILES for 6-amino-3-methyl-7,9-dihydropurine-2,8-dione is Cn1c(=O)nc(N)c2[nH]c(=O)[nH]c21.
What is the InChIKey of 6-amino-3-methyl-7,9-dihydropurine-2,8-dione?
The InChIKey is BSAPZRLBMDNWIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5O2/c1-11-4-2(8-5(12)10-4)3(7)9-6(11)13/h1H3,(H2,7,9,13)(H2,8,10,12).
What are the key properties of 6-amino-3-methyl-7,9-dihydropurine-2,8-dione?
6-amino-3-methyl-7,9-dihydropurine-2,8-dione has a molecular weight of 181.16 g/mol, XLogP of -1.47, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3-methyl-7,9-dihydropurine-2,8-dione is sourced from PubChem (CID 137180919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).