About methyl 3-amino-2-hydroxy-6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate
methyl 3-amino-2-hydroxy-6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate (PubChem CID 137181050) has the molecular formula C8H8N2O4
and a molecular weight of 196.16 g/mol. Its IUPAC name is methyl 3-amino-2-hydroxy-6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 3-amino-2-hydroxy-6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate |
| PubChem CID | 137181050 |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | methyl 3-amino-2-hydroxy-6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate |
| SMILES | [H]/N=C1\C(=O)C=C(N)C(O)=C1C(=O)OC |
| InChI | InChI=1S/C8H8N2O4/c1-14-8(13)5-6(10)4(11)2-3(9)7(5)12/h2,10,12H,9H2,1H3/b10-6+ |
| InChIKey | IWVNMIRAUFETOK-UXBLZVDNSA-N |
| XLogP | -0.58 |
| TPSA | 113.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-amino-2-hydroxy-6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-amino-2-hydroxy-6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of methyl 3-amino-2-hydroxy-6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate (CID 137181050) is methyl 3-amino-2-hydroxy-6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for methyl 3-amino-2-hydroxy-6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for methyl 3-amino-2-hydroxy-6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate is [H]/N=C1\C(=O)C=C(N)C(O)=C1C(=O)OC.
What is the InChIKey of methyl 3-amino-2-hydroxy-6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate?
The InChIKey is IWVNMIRAUFETOK-UXBLZVDNSA-N. The full InChI is InChI=1S/C8H8N2O4/c1-14-8(13)5-6(10)4(11)2-3(9)7(5)12/h2,10,12H,9H2,1H3/b10-6+.
What are the key properties of methyl 3-amino-2-hydroxy-6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate?
methyl 3-amino-2-hydroxy-6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate has a molecular weight of 196.16 g/mol, XLogP of -0.58, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-2-hydroxy-6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 137181050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).