C21H27N5O2 — CID 137181353
N-[1-(oxan-2-yl)indazol-3-yl]spiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine (PubChem CID 137181353) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-[1-(oxan-2-yl)indazol-3-yl]spiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine.
| Compound Name | N-[1-(oxan-2-yl)indazol-3-yl]spiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine |
|---|---|
| PubChem CID | 137181353 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-[1-(oxan-2-yl)indazol-3-yl]spiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine |
| SMILES | c1ccc2c(c1)c(/N=C1/CC3(CN4CCC3CC4)ON1)nn2C1CCCCO1 |
| InChI | InChI=1S/C21H27N5O2/c1-2-6-17-16(5-1)20(23-26(17)19-7-3-4-12-27-19)22-18-13-21(28-24-18)14-25-10-8-15(21)9-11-25/h1-2,5-6,15,19H,3-4,7-14H2,(H,22,23,24) |
| InChIKey | BBTPCKZATXEZRK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|