C46H31F4N5O3S — CID 137181420
3-[10,20-bis(3-hydroxyphenyl)-15-[2,3,5,6-tetrafluoro-4-(2-sulfanylethylamino)phenyl]-21,23-dihydroporphyrin-5-yl]phenol (PubChem CID 137181420) has the molecular formula C46H31F4N5O3S and a molecular weight of 809.85 g/mol. Its IUPAC name is 3-[10,20-bis(3-hydroxyphenyl)-15-[2,3,5,6-tetrafluoro-4-(2-sulfanylethylamino)phenyl]-21,23-dihydroporphyrin-5-yl]phenol.
| Compound Name | 3-[10,20-bis(3-hydroxyphenyl)-15-[2,3,5,6-tetrafluoro-4-(2-sulfanylethylamino)phenyl]-21,23-dihydroporphyrin-5-yl]phenol |
|---|---|
| PubChem CID | 137181420 |
| Molecular Formula | C46H31F4N5O3S |
| Molecular Weight | 809.85 g/mol |
| Exact Mass | 809.21 |
| IUPAC Name | 3-[10,20-bis(3-hydroxyphenyl)-15-[2,3,5,6-tetrafluoro-4-(2-sulfanylethylamino)phenyl]-21,23-dihydroporphyrin-5-yl]phenol |
| SMILES | Oc1cccc(-c2c3nc(c(-c4cccc(O)c4)c4ccc([nH]4)c(-c4c(F)c(F)c(NCCS)c(F)c4F)c4nc(c(-c5cccc(O)c5)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C46H31F4N5O3S/c47-42-41(43(48)45(50)46(44(42)49)51-18-19-59)40-35-16-14-33(54-35)38(24-5-2-8-27(57)21-24)31-12-10-29(52-31)37(23-4-1-7-26(56)20-23)30-11-13-32(53-30)39(34-15-17-36(40)55-34)25-6-3-9-28(58)22-25/h1-17,20-22,51-52,55-59H,18-19H2/b37-29-,37-30-,38-31-,38-33-,39-32-,39-34-,40-35+,40-36+ |
| InChIKey | LTVBBKKZMVULNA-PKGMDYGPSA-N |
| XLogP | 11.34 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.85 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|