C50H38F4N6O5S2 — CID 137181423
methyl N-[2-[2-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(3-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]anilino]ethyldisulfanyl]ethyl]carbamate (PubChem CID 137181423) has the molecular formula C50H38F4N6O5S2 and a molecular weight of 943.02 g/mol. Its IUPAC name is methyl N-[2-[2-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(3-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]anilino]ethyldisulfanyl]ethyl]carbamate.
| Compound Name | methyl N-[2-[2-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(3-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]anilino]ethyldisulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 137181423 |
| Molecular Formula | C50H38F4N6O5S2 |
| Molecular Weight | 943.02 g/mol |
| Exact Mass | 942.23 |
| IUPAC Name | methyl N-[2-[2-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(3-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]anilino]ethyldisulfanyl]ethyl]carbamate |
| SMILES | COC(=O)NCCSSCCNc1c(F)c(F)c(-c2c3nc(c(-c4cccc(O)c4)c4ccc([nH]4)c(-c4cccc(O)c4)c4nc(c(-c5cccc(O)c5)c5ccc2[nH]5)C=C4)C=C3)c(F)c1F |
| InChI | InChI=1S/C50H38F4N6O5S2/c1-65-50(64)56-20-22-67-66-21-19-55-49-47(53)45(51)44(46(52)48(49)54)43-38-17-15-36(59-38)41(27-6-3-9-30(62)24-27)34-13-11-32(57-34)40(26-5-2-8-29(61)23-26)33-12-14-35(58-33)42(37-16-18-39(43)60-37)28-7-4-10-31(63)25-28/h2-18,23-25,55,57,60-63H,19-22H2,1H3,(H,56,64)/b40-32-,40-33-,41-34-,41-36-,42-35-,42-37-,43-38+,43-39+ |
| InChIKey | GJHCOMAQIWAJDL-RYCYNUCPSA-N |
| XLogP | 12.15 |
| TPSA | 168.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.02 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|