About 6H-triazolo[5,1-d][1,2,5]triazepine
6H-triazolo[5,1-d][1,2,5]triazepine (PubChem CID 137182489) has the molecular formula C5H5N5
and a molecular weight of 135.13 g/mol. Its IUPAC name is 6H-triazolo[5,1-d][1,2,5]triazepine.
Molecular Properties
| Compound Name | 6H-triazolo[5,1-d][1,2,5]triazepine |
| PubChem CID | 137182489 |
| Molecular Formula | C5H5N5 |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | 6H-triazolo[5,1-d][1,2,5]triazepine |
| SMILES | C1=Cn2nncc2C=NN1 |
| InChI | InChI=1S/C5H5N5/c1-2-10-5(3-7-6-1)4-8-9-10/h1-4,6H |
| InChIKey | NZFKPGTYNNTLIB-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6H-triazolo[5,1-d][1,2,5]triazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-triazolo[5,1-d][1,2,5]triazepine?
The IUPAC name of 6H-triazolo[5,1-d][1,2,5]triazepine (CID 137182489) is 6H-triazolo[5,1-d][1,2,5]triazepine.
What is the SMILES notation for 6H-triazolo[5,1-d][1,2,5]triazepine?
The canonical SMILES for 6H-triazolo[5,1-d][1,2,5]triazepine is C1=Cn2nncc2C=NN1.
What is the InChIKey of 6H-triazolo[5,1-d][1,2,5]triazepine?
The InChIKey is NZFKPGTYNNTLIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5/c1-2-10-5(3-7-6-1)4-8-9-10/h1-4,6H.
What are the key properties of 6H-triazolo[5,1-d][1,2,5]triazepine?
6H-triazolo[5,1-d][1,2,5]triazepine has a molecular weight of 135.13 g/mol, XLogP of -0.36, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-triazolo[5,1-d][1,2,5]triazepine is sourced from PubChem (CID 137182489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).