C14H10F9N3O2 — CID 137183593
3-hydroxyimino-4-methyl-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1H-1,5-benzodiazepin-2-ol (PubChem CID 137183593) has the molecular formula C14H10F9N3O2 and a molecular weight of 423.24 g/mol. Its IUPAC name is 3-hydroxyimino-4-methyl-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1H-1,5-benzodiazepin-2-ol.
| Compound Name | 3-hydroxyimino-4-methyl-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1H-1,5-benzodiazepin-2-ol |
|---|---|
| PubChem CID | 137183593 |
| Molecular Formula | C14H10F9N3O2 |
| Molecular Weight | 423.24 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 3-hydroxyimino-4-methyl-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1H-1,5-benzodiazepin-2-ol |
| SMILES | CC1=Nc2ccccc2NC(O)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1=NO |
| InChI | InChI=1S/C14H10F9N3O2/c1-6-9(26-28)10(27,25-8-5-3-2-4-7(8)24-6)11(15,16)12(17,18)13(19,20)14(21,22)23/h2-5,25,27-28H,1H3 |
| InChIKey | XSQYOFUXARREHA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.24 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|