About 3-hydroxyimino-4-methyl-2-(trifluoromethyl)-1H-1,5-benzodiazepin-2-ol
3-hydroxyimino-4-methyl-2-(trifluoromethyl)-1H-1,5-benzodiazepin-2-ol (PubChem CID 137183601) has the molecular formula C11H10F3N3O2
and a molecular weight of 273.21 g/mol. Its IUPAC name is 3-hydroxyimino-4-methyl-2-(trifluoromethyl)-1H-1,5-benzodiazepin-2-ol.
Molecular Properties
| Compound Name | 3-hydroxyimino-4-methyl-2-(trifluoromethyl)-1H-1,5-benzodiazepin-2-ol |
| PubChem CID | 137183601 |
| Molecular Formula | C11H10F3N3O2 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 3-hydroxyimino-4-methyl-2-(trifluoromethyl)-1H-1,5-benzodiazepin-2-ol |
| SMILES | CC1=Nc2ccccc2NC(O)(C(F)(F)F)C1=NO |
| InChI | InChI=1S/C11H10F3N3O2/c1-6-9(17-19)10(18,11(12,13)14)16-8-5-3-2-4-7(8)15-6/h2-5,16,18-19H,1H3 |
| InChIKey | VQGXMAAEYVTSKX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxyimino-4-methyl-2-(trifluoromethyl)-1H-1,5-benzodiazepin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxyimino-4-methyl-2-(trifluoromethyl)-1H-1,5-benzodiazepin-2-ol?
The IUPAC name of 3-hydroxyimino-4-methyl-2-(trifluoromethyl)-1H-1,5-benzodiazepin-2-ol (CID 137183601) is 3-hydroxyimino-4-methyl-2-(trifluoromethyl)-1H-1,5-benzodiazepin-2-ol.
What is the SMILES notation for 3-hydroxyimino-4-methyl-2-(trifluoromethyl)-1H-1,5-benzodiazepin-2-ol?
The canonical SMILES for 3-hydroxyimino-4-methyl-2-(trifluoromethyl)-1H-1,5-benzodiazepin-2-ol is CC1=Nc2ccccc2NC(O)(C(F)(F)F)C1=NO.
What is the InChIKey of 3-hydroxyimino-4-methyl-2-(trifluoromethyl)-1H-1,5-benzodiazepin-2-ol?
The InChIKey is VQGXMAAEYVTSKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3N3O2/c1-6-9(17-19)10(18,11(12,13)14)16-8-5-3-2-4-7(8)15-6/h2-5,16,18-19H,1H3.
What are the key properties of 3-hydroxyimino-4-methyl-2-(trifluoromethyl)-1H-1,5-benzodiazepin-2-ol?
3-hydroxyimino-4-methyl-2-(trifluoromethyl)-1H-1,5-benzodiazepin-2-ol has a molecular weight of 273.21 g/mol, XLogP of 2.29, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyimino-4-methyl-2-(trifluoromethyl)-1H-1,5-benzodiazepin-2-ol is sourced from PubChem (CID 137183601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).