C12H20ClN3O3S — CID 137184304
(3aR,5R,6S,7R,7aR)-5-[[chloro(prop-2-enyl)amino]methyl]-2-ethylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 137184304) has the molecular formula C12H20ClN3O3S and a molecular weight of 321.83 g/mol. Its IUPAC name is (3aR,5R,6S,7R,7aR)-5-[[chloro(prop-2-enyl)amino]methyl]-2-ethylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | (3aR,5R,6S,7R,7aR)-5-[[chloro(prop-2-enyl)amino]methyl]-2-ethylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 137184304 |
| Molecular Formula | C12H20ClN3O3S |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | (3aR,5R,6S,7R,7aR)-5-[[chloro(prop-2-enyl)amino]methyl]-2-ethylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | C=CCN(Cl)C[C@H]1O[C@@H]2S/C(=N\CC)N[C@@H]2[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H20ClN3O3S/c1-3-5-16(13)6-7-9(17)10(18)8-11(19-7)20-12(15-8)14-4-2/h3,7-11,17-18H,1,4-6H2,2H3,(H,14,15)/t7-,8-,9-,10-,11-/m1/s1 |
| InChIKey | VDPGTPWYAZXGMR-ISUQUUIWSA-N |
| XLogP | 0.16 |
| TPSA | 77.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|