C7H11N3OS — CID 137184742
3-cyclopentylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 137184742) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is 3-cyclopentylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-cyclopentylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 137184742 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 3-cyclopentylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(SC2CCCC2)[nH]1 |
| InChI | InChI=1S/C7H11N3OS/c11-6-8-7(10-9-6)12-5-3-1-2-4-5/h5H,1-4H2,(H2,8,9,10,11) |
| InChIKey | SFAQCRHVWYPDSF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |