C25H17N3O4 — CID 137185689
2-(1,3-benzodioxol-5-ylmethyl)-20-oxa-5,6,12-triazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4(8),6,9,14,16,18-octaen-21-one (PubChem CID 137185689) has the molecular formula C25H17N3O4 and a molecular weight of 423.43 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-20-oxa-5,6,12-triazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4(8),6,9,14,16,18-octaen-21-one.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-20-oxa-5,6,12-triazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4(8),6,9,14,16,18-octaen-21-one |
|---|---|
| PubChem CID | 137185689 |
| Molecular Formula | C25H17N3O4 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-20-oxa-5,6,12-triazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4(8),6,9,14,16,18-octaen-21-one |
| SMILES | O=c1oc2ccccc2c2c1C(Cc1ccc3c(c1)OCO3)c1c(ccc3cn[nH]c13)N2 |
| InChI | InChI=1S/C25H17N3O4/c29-25-22-16(9-13-5-8-19-20(10-13)31-12-30-19)21-17(7-6-14-11-26-28-23(14)21)27-24(22)15-3-1-2-4-18(15)32-25/h1-8,10-11,16,27H,9,12H2,(H,26,28) |
| InChIKey | LVPLLPFEWQTTEO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|