C24H17N3O2 — CID 137185692
2-(4-methylphenyl)-20-oxa-5,6,12-triazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4(8),6,9,14,16,18-octaen-21-one (PubChem CID 137185692) has the molecular formula C24H17N3O2 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-(4-methylphenyl)-20-oxa-5,6,12-triazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4(8),6,9,14,16,18-octaen-21-one.
| Compound Name | 2-(4-methylphenyl)-20-oxa-5,6,12-triazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4(8),6,9,14,16,18-octaen-21-one |
|---|---|
| PubChem CID | 137185692 |
| Molecular Formula | C24H17N3O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 2-(4-methylphenyl)-20-oxa-5,6,12-triazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4(8),6,9,14,16,18-octaen-21-one |
| SMILES | Cc1ccc(C2c3c(c4ccccc4oc3=O)Nc3ccc4cn[nH]c4c32)cc1 |
| InChI | InChI=1S/C24H17N3O2/c1-13-6-8-14(9-7-13)19-20-17(11-10-15-12-25-27-22(15)20)26-23-16-4-2-3-5-18(16)29-24(28)21(19)23/h2-12,19,26H,1H3,(H,25,27) |
| InChIKey | CKVZLJYAOJQXEY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|