C10H10FN5O3 — CID 137186133
N-[[2-fluoro-6-(5-oxo-1H-tetrazol-4-yl)phenyl]methoxy]acetamide (PubChem CID 137186133) has the molecular formula C10H10FN5O3 and a molecular weight of 267.22 g/mol. Its IUPAC name is N-[[2-fluoro-6-(5-oxo-1H-tetrazol-4-yl)phenyl]methoxy]acetamide.
| Compound Name | N-[[2-fluoro-6-(5-oxo-1H-tetrazol-4-yl)phenyl]methoxy]acetamide |
|---|---|
| PubChem CID | 137186133 |
| Molecular Formula | C10H10FN5O3 |
| Molecular Weight | 267.22 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | N-[[2-fluoro-6-(5-oxo-1H-tetrazol-4-yl)phenyl]methoxy]acetamide |
| SMILES | CC(=O)NOCc1c(F)cccc1-n1nn[nH]c1=O |
| InChI | InChI=1S/C10H10FN5O3/c1-6(17)13-19-5-7-8(11)3-2-4-9(7)16-10(18)12-14-15-16/h2-4H,5H2,1H3,(H,13,17)(H,12,15,18) |
| InChIKey | AWXZLGZNPQRHNY-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.22 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|