C11H12ClN5O3 — CID 137186134
N-[[2-chloro-6-(5-oxo-1H-tetrazol-4-yl)phenyl]methoxy]propanamide (PubChem CID 137186134) has the molecular formula C11H12ClN5O3 and a molecular weight of 297.70 g/mol. Its IUPAC name is N-[[2-chloro-6-(5-oxo-1H-tetrazol-4-yl)phenyl]methoxy]propanamide.
| Compound Name | N-[[2-chloro-6-(5-oxo-1H-tetrazol-4-yl)phenyl]methoxy]propanamide |
|---|---|
| PubChem CID | 137186134 |
| Molecular Formula | C11H12ClN5O3 |
| Molecular Weight | 297.70 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | N-[[2-chloro-6-(5-oxo-1H-tetrazol-4-yl)phenyl]methoxy]propanamide |
| SMILES | CCC(=O)NOCc1c(Cl)cccc1-n1nn[nH]c1=O |
| InChI | InChI=1S/C11H12ClN5O3/c1-2-10(18)14-20-6-7-8(12)4-3-5-9(7)17-11(19)13-15-16-17/h3-5H,2,6H2,1H3,(H,14,18)(H,13,16,19) |
| InChIKey | LNVRJNKWTWWVBI-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.70 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|