About 4-(6-oxo-1,7-dihydropurin-2-yl)pyridine-2-carboxamide
4-(6-oxo-1,7-dihydropurin-2-yl)pyridine-2-carboxamide (PubChem CID 137186641) has the molecular formula C11H8N6O2
and a molecular weight of 256.23 g/mol. Its IUPAC name is 4-(6-oxo-1,7-dihydropurin-2-yl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 4-(6-oxo-1,7-dihydropurin-2-yl)pyridine-2-carboxamide |
| PubChem CID | 137186641 |
| Molecular Formula | C11H8N6O2 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 4-(6-oxo-1,7-dihydropurin-2-yl)pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(-c2nc3nc[nH]c3c(=O)[nH]2)ccn1 |
| InChI | InChI=1S/C11H8N6O2/c12-8(18)6-3-5(1-2-13-6)9-16-10-7(11(19)17-9)14-4-15-10/h1-4H,(H2,12,18)(H2,14,15,16,17,19) |
| InChIKey | LHILIDOAVVGJDZ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 130.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(6-oxo-1,7-dihydropurin-2-yl)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-oxo-1,7-dihydropurin-2-yl)pyridine-2-carboxamide?
The IUPAC name of 4-(6-oxo-1,7-dihydropurin-2-yl)pyridine-2-carboxamide (CID 137186641) is 4-(6-oxo-1,7-dihydropurin-2-yl)pyridine-2-carboxamide.
What is the SMILES notation for 4-(6-oxo-1,7-dihydropurin-2-yl)pyridine-2-carboxamide?
The canonical SMILES for 4-(6-oxo-1,7-dihydropurin-2-yl)pyridine-2-carboxamide is NC(=O)c1cc(-c2nc3nc[nH]c3c(=O)[nH]2)ccn1.
What is the InChIKey of 4-(6-oxo-1,7-dihydropurin-2-yl)pyridine-2-carboxamide?
The InChIKey is LHILIDOAVVGJDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N6O2/c12-8(18)6-3-5(1-2-13-6)9-16-10-7(11(19)17-9)14-4-15-10/h1-4H,(H2,12,18)(H2,14,15,16,17,19).
What are the key properties of 4-(6-oxo-1,7-dihydropurin-2-yl)pyridine-2-carboxamide?
4-(6-oxo-1,7-dihydropurin-2-yl)pyridine-2-carboxamide has a molecular weight of 256.23 g/mol, XLogP of -0.19, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-oxo-1,7-dihydropurin-2-yl)pyridine-2-carboxamide is sourced from PubChem (CID 137186641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).