C5H9N3OS2 — CID 137187642
3-(2-methylsulfanylethylsulfanyl)-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 137187642) has the molecular formula C5H9N3OS2 and a molecular weight of 191.28 g/mol. Its IUPAC name is 3-(2-methylsulfanylethylsulfanyl)-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-(2-methylsulfanylethylsulfanyl)-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 137187642 |
| Molecular Formula | C5H9N3OS2 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.02 |
| IUPAC Name | 3-(2-methylsulfanylethylsulfanyl)-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | CSCCSc1n[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C5H9N3OS2/c1-10-2-3-11-5-6-4(9)7-8-5/h2-3H2,1H3,(H2,6,7,8,9) |
| InChIKey | WTTLFNSFFZZJRG-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|