C19H16Br3N4O3S+ — CID 137188925
(6R)-10-bromo-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-3-ethylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137188925) has the molecular formula C19H16Br3N4O3S+ and a molecular weight of 620.14 g/mol. Its IUPAC name is (6R)-10-bromo-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-3-ethylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6R)-10-bromo-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-3-ethylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137188925 |
| Molecular Formula | C19H16Br3N4O3S+ |
| Molecular Weight | 620.14 g/mol |
| Exact Mass | 616.85 |
| IUPAC Name | (6R)-10-bromo-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-3-ethylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CCSc1n[n+]2c(c(=O)[nH]1)-c1cc(Br)ccc1N[C@H]2c1cc(OC)c(O)c(Br)c1Br |
| InChI | InChI=1S/C19H15Br3N4O3S/c1-3-30-19-24-18(28)15-9-6-8(20)4-5-11(9)23-17(26(15)25-19)10-7-12(29-2)16(27)14(22)13(10)21/h4-7,17H,3H2,1-2H3,(H2,24,25,27,28)/p+1/t17-/m1/s1 |
| InChIKey | MYBKAVAXSREOLU-QGZVFWFLSA-O |
| XLogP | 4.81 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.14 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|