C20H20N5O2S+ — CID 137189462
(6S)-7-acetyl-3-propylsulfanyl-6-pyridin-4-yl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137189462) has the molecular formula C20H20N5O2S+ and a molecular weight of 394.48 g/mol. Its IUPAC name is (6S)-7-acetyl-3-propylsulfanyl-6-pyridin-4-yl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6S)-7-acetyl-3-propylsulfanyl-6-pyridin-4-yl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137189462 |
| Molecular Formula | C20H20N5O2S+ |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (6S)-7-acetyl-3-propylsulfanyl-6-pyridin-4-yl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CCCSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N(C(C)=O)[C@@H]2c1ccncc1 |
| InChI | InChI=1S/C20H19N5O2S/c1-3-12-28-20-22-18(27)17-15-6-4-5-7-16(15)24(13(2)26)19(25(17)23-20)14-8-10-21-11-9-14/h4-11,19H,3,12H2,1-2H3/p+1/t19-/m0/s1 |
| InChIKey | WEOPZDHLDPRTRS-IBGZPJMESA-O |
| XLogP | 2.53 |
| TPSA | 82.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|