About 4-(4,5-diphenyl-1H-pyrrol-3-yl)-2-(4-methylphenyl)-6H-pyrazolo[3,4-d]pyridazin-7-one
4-(4,5-diphenyl-1H-pyrrol-3-yl)-2-(4-methylphenyl)-6H-pyrazolo[3,4-d]pyridazin-7-one (PubChem CID 137189951) has the molecular formula C28H21N5O
and a molecular weight of 443.51 g/mol. Its IUPAC name is 4-(4,5-diphenyl-1H-pyrrol-3-yl)-2-(4-methylphenyl)-6H-pyrazolo[3,4-d]pyridazin-7-one.
Molecular Properties
| Compound Name | 4-(4,5-diphenyl-1H-pyrrol-3-yl)-2-(4-methylphenyl)-6H-pyrazolo[3,4-d]pyridazin-7-one |
| PubChem CID | 137189951 |
| Molecular Formula | C28H21N5O |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 4-(4,5-diphenyl-1H-pyrrol-3-yl)-2-(4-methylphenyl)-6H-pyrazolo[3,4-d]pyridazin-7-one |
| SMILES | Cc1ccc(-n2cc3c(-c4c[nH]c(-c5ccccc5)c4-c4ccccc4)n[nH]c(=O)c3n2)cc1 |
| InChI | InChI=1S/C28H21N5O/c1-18-12-14-21(15-13-18)33-17-23-26(30-31-28(34)27(23)32-33)22-16-29-25(20-10-6-3-7-11-20)24(22)19-8-4-2-5-9-19/h2-17,29H,1H3,(H,31,34) |
| InChIKey | ULRHQDXXTVKDTL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 79.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4,5-diphenyl-1H-pyrrol-3-yl)-2-(4-methylphenyl)-6H-pyrazolo[3,4-d]pyridazin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-diphenyl-1H-pyrrol-3-yl)-2-(4-methylphenyl)-6H-pyrazolo[3,4-d]pyridazin-7-one?
The IUPAC name of 4-(4,5-diphenyl-1H-pyrrol-3-yl)-2-(4-methylphenyl)-6H-pyrazolo[3,4-d]pyridazin-7-one (CID 137189951) is 4-(4,5-diphenyl-1H-pyrrol-3-yl)-2-(4-methylphenyl)-6H-pyrazolo[3,4-d]pyridazin-7-one.
What is the SMILES notation for 4-(4,5-diphenyl-1H-pyrrol-3-yl)-2-(4-methylphenyl)-6H-pyrazolo[3,4-d]pyridazin-7-one?
The canonical SMILES for 4-(4,5-diphenyl-1H-pyrrol-3-yl)-2-(4-methylphenyl)-6H-pyrazolo[3,4-d]pyridazin-7-one is Cc1ccc(-n2cc3c(-c4c[nH]c(-c5ccccc5)c4-c4ccccc4)n[nH]c(=O)c3n2)cc1.
What is the InChIKey of 4-(4,5-diphenyl-1H-pyrrol-3-yl)-2-(4-methylphenyl)-6H-pyrazolo[3,4-d]pyridazin-7-one?
The InChIKey is ULRHQDXXTVKDTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H21N5O/c1-18-12-14-21(15-13-18)33-17-23-26(30-31-28(34)27(23)32-33)22-16-29-25(20-10-6-3-7-11-20)24(22)19-8-4-2-5-9-19/h2-17,29H,1H3,(H,31,34).
What are the key properties of 4-(4,5-diphenyl-1H-pyrrol-3-yl)-2-(4-methylphenyl)-6H-pyrazolo[3,4-d]pyridazin-7-one?
4-(4,5-diphenyl-1H-pyrrol-3-yl)-2-(4-methylphenyl)-6H-pyrazolo[3,4-d]pyridazin-7-one has a molecular weight of 443.51 g/mol, XLogP of 5.75, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-diphenyl-1H-pyrrol-3-yl)-2-(4-methylphenyl)-6H-pyrazolo[3,4-d]pyridazin-7-one is sourced from PubChem (CID 137189951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).